C28H29N5O2 — CID 143782923
8-[5-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-1H-imidazol-2-yl]octan-3-one (PubChem CID 143782923) has the molecular formula C28H29N5O2 and a molecular weight of 467.57 g/mol. Its IUPAC name is 8-[5-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-1H-imidazol-2-yl]octan-3-one.
| Compound Name | 8-[5-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-1H-imidazol-2-yl]octan-3-one |
|---|---|
| PubChem CID | 143782923 |
| Molecular Formula | C28H29N5O2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 8-[5-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-1H-imidazol-2-yl]octan-3-one |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(-c4cnc(CCCCCC(=O)CC)[nH]4)cc23)c1 |
| InChI | InChI=1S/C28H29N5O2/c1-4-19-10-9-11-20(14-19)32-28-23-15-22(26(35-3)16-24(23)30-18-31-28)25-17-29-27(33-25)13-8-6-7-12-21(34)5-2/h1,9-11,14-18H,5-8,12-13H2,2-3H3,(H,29,33)(H,30,31,32) |
| InChIKey | NIIJXOMEOZTZEM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|