C25H25ClFN5O — CID 58998085
N-(3-chloro-4-fluorophenyl)-7-ethoxy-6-[3-[2-isocyanoethyl(methyl)amino]-3-methylbut-1-ynyl]quinazolin-4-amine (PubChem CID 58998085) has the molecular formula C25H25ClFN5O and a molecular weight of 465.96 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-7-ethoxy-6-[3-[2-isocyanoethyl(methyl)amino]-3-methylbut-1-ynyl]quinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-7-ethoxy-6-[3-[2-isocyanoethyl(methyl)amino]-3-methylbut-1-ynyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 58998085 |
| Molecular Formula | C25H25ClFN5O |
| Molecular Weight | 465.96 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-7-ethoxy-6-[3-[2-isocyanoethyl(methyl)amino]-3-methylbut-1-ynyl]quinazolin-4-amine |
| SMILES | [C-]#[N+]CCN(C)C(C)(C)C#Cc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCC |
| InChI | InChI=1S/C25H25ClFN5O/c1-6-33-23-15-22-19(13-17(23)9-10-25(2,3)32(5)12-11-28-4)24(30-16-29-22)31-18-7-8-21(27)20(26)14-18/h7-8,13-16H,6,11-12H2,1-3,5H3,(H,29,30,31) |
| InChIKey | PUUBZPGKNNLPPG-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 54.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.96 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|