C23H26ClFN3O5P — CID 159362199
1-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-3-diethoxyphosphorylpropan-2-one (PubChem CID 159362199) has the molecular formula C23H26ClFN3O5P and a molecular weight of 509.90 g/mol. Its IUPAC name is 1-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-3-diethoxyphosphorylpropan-2-one.
| Compound Name | 1-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-3-diethoxyphosphorylpropan-2-one |
|---|---|
| PubChem CID | 159362199 |
| Molecular Formula | C23H26ClFN3O5P |
| Molecular Weight | 509.90 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 1-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-3-diethoxyphosphorylpropan-2-one |
| SMILES | CCOc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1CC(=O)CP(=O)(OCC)OCC |
| InChI | InChI=1S/C23H26ClFN3O5P/c1-4-31-22-12-21-18(10-15(22)9-17(29)13-34(30,32-5-2)33-6-3)23(27-14-26-21)28-16-7-8-20(25)19(24)11-16/h7-8,10-12,14H,4-6,9,13H2,1-3H3,(H,26,27,28) |
| InChIKey | WYFFAILDSLDSHR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.90 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|