C24H28ClFN3O6P — CID 159161370
1-[4-(3-chloro-4-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]-3-diethoxyphosphorylpropan-2-one (PubChem CID 159161370) has the molecular formula C24H28ClFN3O6P and a molecular weight of 539.93 g/mol. Its IUPAC name is 1-[4-(3-chloro-4-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]-3-diethoxyphosphorylpropan-2-one.
| Compound Name | 1-[4-(3-chloro-4-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]-3-diethoxyphosphorylpropan-2-one |
|---|---|
| PubChem CID | 159161370 |
| Molecular Formula | C24H28ClFN3O6P |
| Molecular Weight | 539.93 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | 1-[4-(3-chloro-4-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]-3-diethoxyphosphorylpropan-2-one |
| SMILES | CCOP(=O)(CC(=O)Cc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCCOC)OCC |
| InChI | InChI=1S/C24H28ClFN3O6P/c1-4-34-36(31,35-5-2)14-18(30)10-16-11-19-22(13-23(16)33-9-8-32-3)27-15-28-24(19)29-17-6-7-21(26)20(25)12-17/h6-7,11-13,15H,4-5,8-10,14H2,1-3H3,(H,27,28,29) |
| InChIKey | CYHAXYAQWXVYCA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.93 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|