C28H33ClFN5O — CID 58998362
N-(3-chloro-4-fluorophenyl)-7-ethoxy-6-[3-ethyl-3-(4-methylpiperazin-1-yl)pent-1-ynyl]quinazolin-4-amine (PubChem CID 58998362) has the molecular formula C28H33ClFN5O and a molecular weight of 510.06 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-7-ethoxy-6-[3-ethyl-3-(4-methylpiperazin-1-yl)pent-1-ynyl]quinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-7-ethoxy-6-[3-ethyl-3-(4-methylpiperazin-1-yl)pent-1-ynyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 58998362 |
| Molecular Formula | C28H33ClFN5O |
| Molecular Weight | 510.06 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-7-ethoxy-6-[3-ethyl-3-(4-methylpiperazin-1-yl)pent-1-ynyl]quinazolin-4-amine |
| SMILES | CCOc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1C#CC(CC)(CC)N1CCN(C)CC1 |
| InChI | InChI=1S/C28H33ClFN5O/c1-5-28(6-2,35-14-12-34(4)13-15-35)11-10-20-16-22-25(18-26(20)36-7-3)31-19-32-27(22)33-21-8-9-24(30)23(29)17-21/h8-9,16-19H,5-7,12-15H2,1-4H3,(H,31,32,33) |
| InChIKey | PBGSSXGSIGZUSE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.06 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|