C23H23ClFN5O — CID 58998309
4-N-(3-chloro-4-fluorophenyl)-7-(3-methyl-3-morpholin-4-ylbut-1-ynyl)quinazoline-4,6-diamine (PubChem CID 58998309) has the molecular formula C23H23ClFN5O and a molecular weight of 439.92 g/mol. Its IUPAC name is 4-N-(3-chloro-4-fluorophenyl)-7-(3-methyl-3-morpholin-4-ylbut-1-ynyl)quinazoline-4,6-diamine.
| Compound Name | 4-N-(3-chloro-4-fluorophenyl)-7-(3-methyl-3-morpholin-4-ylbut-1-ynyl)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 58998309 |
| Molecular Formula | C23H23ClFN5O |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 4-N-(3-chloro-4-fluorophenyl)-7-(3-methyl-3-morpholin-4-ylbut-1-ynyl)quinazoline-4,6-diamine |
| SMILES | CC(C)(C#Cc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1N)N1CCOCC1 |
| InChI | InChI=1S/C23H23ClFN5O/c1-23(2,30-7-9-31-10-8-30)6-5-15-11-21-17(13-20(15)26)22(28-14-27-21)29-16-3-4-19(25)18(24)12-16/h3-4,11-14H,7-10,26H2,1-2H3,(H,27,28,29) |
| InChIKey | VBBMLDRMDGPWDJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|