C26H26ClFN6O — CID 58998004
N-[4-(3-chloro-4-fluoroanilino)-7-(3-methyl-3-piperazin-1-ylbut-1-ynyl)quinazolin-6-yl]prop-2-enamide (PubChem CID 58998004) has the molecular formula C26H26ClFN6O and a molecular weight of 492.99 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-7-(3-methyl-3-piperazin-1-ylbut-1-ynyl)quinazolin-6-yl]prop-2-enamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-7-(3-methyl-3-piperazin-1-ylbut-1-ynyl)quinazolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 58998004 |
| Molecular Formula | C26H26ClFN6O |
| Molecular Weight | 492.99 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-7-(3-methyl-3-piperazin-1-ylbut-1-ynyl)quinazolin-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1C#CC(C)(C)N1CCNCC1 |
| InChI | InChI=1S/C26H26ClFN6O/c1-4-24(35)33-22-15-19-23(13-17(22)7-8-26(2,3)34-11-9-29-10-12-34)30-16-31-25(19)32-18-5-6-21(28)20(27)14-18/h4-6,13-16,29H,1,9-12H2,2-3H3,(H,33,35)(H,30,31,32) |
| InChIKey | RIGGQFJXTCFFLK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.99 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|