C25H27ClFN5OS — CID 11706012
(E)-N-[4-(3-chloro-4-fluoroanilino)-7-methylsulfanylquinazolin-6-yl]-5-piperidin-1-ylpent-2-enamide (PubChem CID 11706012) has the molecular formula C25H27ClFN5OS and a molecular weight of 500.04 g/mol. Its IUPAC name is (E)-N-[4-(3-chloro-4-fluoroanilino)-7-methylsulfanylquinazolin-6-yl]-5-piperidin-1-ylpent-2-enamide.
| Compound Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-methylsulfanylquinazolin-6-yl]-5-piperidin-1-ylpent-2-enamide |
|---|---|
| PubChem CID | 11706012 |
| Molecular Formula | C25H27ClFN5OS |
| Molecular Weight | 500.04 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | (E)-N-[4-(3-chloro-4-fluoroanilino)-7-methylsulfanylquinazolin-6-yl]-5-piperidin-1-ylpent-2-enamide |
| SMILES | CSc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1NC(=O)/C=C/CCN1CCCCC1 |
| InChI | InChI=1S/C25H27ClFN5OS/c1-34-23-15-21-18(25(29-16-28-21)30-17-8-9-20(27)19(26)13-17)14-22(23)31-24(33)7-3-6-12-32-10-4-2-5-11-32/h3,7-9,13-16H,2,4-6,10-12H2,1H3,(H,31,33)(H,28,29,30)/b7-3+ |
| InChIKey | AGUFCCWPWNOHFE-XVNBXDOJSA-N |
| XLogP | 6.26 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.04 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|