C29H35N7O — CID 58998356
N-[4-[4-(dimethylamino)anilino]-7-[3-methyl-3-(4-methylpiperazin-1-yl)but-1-ynyl]quinazolin-6-yl]prop-2-enamide (PubChem CID 58998356) has the molecular formula C29H35N7O and a molecular weight of 497.65 g/mol. Its IUPAC name is N-[4-[4-(dimethylamino)anilino]-7-[3-methyl-3-(4-methylpiperazin-1-yl)but-1-ynyl]quinazolin-6-yl]prop-2-enamide.
| Compound Name | N-[4-[4-(dimethylamino)anilino]-7-[3-methyl-3-(4-methylpiperazin-1-yl)but-1-ynyl]quinazolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 58998356 |
| Molecular Formula | C29H35N7O |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | N-[4-[4-(dimethylamino)anilino]-7-[3-methyl-3-(4-methylpiperazin-1-yl)but-1-ynyl]quinazolin-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(Nc3ccc(N(C)C)cc3)ncnc2cc1C#CC(C)(C)N1CCN(C)CC1 |
| InChI | InChI=1S/C29H35N7O/c1-7-27(37)33-25-19-24-26(18-21(25)12-13-29(2,3)36-16-14-35(6)15-17-36)30-20-31-28(24)32-22-8-10-23(11-9-22)34(4)5/h7-11,18-20H,1,14-17H2,2-6H3,(H,33,37)(H,30,31,32) |
| InChIKey | VNBCVFJIGYXNKQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|