C27H30FIN6O — CID 89321034
N-[4-[4-fluoro-3-(iodomethyl)anilino]-7-[(E)-4-(4-methylpiperazin-1-yl)but-1-enyl]quinazolin-6-yl]prop-2-enamide (PubChem CID 89321034) has the molecular formula C27H30FIN6O and a molecular weight of 600.48 g/mol. Its IUPAC name is N-[4-[4-fluoro-3-(iodomethyl)anilino]-7-[(E)-4-(4-methylpiperazin-1-yl)but-1-enyl]quinazolin-6-yl]prop-2-enamide.
| Compound Name | N-[4-[4-fluoro-3-(iodomethyl)anilino]-7-[(E)-4-(4-methylpiperazin-1-yl)but-1-enyl]quinazolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89321034 |
| Molecular Formula | C27H30FIN6O |
| Molecular Weight | 600.48 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | N-[4-[4-fluoro-3-(iodomethyl)anilino]-7-[(E)-4-(4-methylpiperazin-1-yl)but-1-enyl]quinazolin-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(Nc3ccc(F)c(CI)c3)ncnc2cc1/C=C/CCN1CCN(C)CC1 |
| InChI | InChI=1S/C27H30FIN6O/c1-3-26(36)33-24-16-22-25(15-19(24)6-4-5-9-35-12-10-34(2)11-13-35)30-18-31-27(22)32-21-7-8-23(28)20(14-21)17-29/h3-4,6-8,14-16,18H,1,5,9-13,17H2,2H3,(H,33,36)(H,30,31,32)/b6-4+ |
| InChIKey | MMCRJDPNOQFKLS-GQCTYLIASA-N |
| XLogP | 5.22 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|