C25H32FIN6O2S — CID 89320962
N-[7-[2-(4-ethylpiperazin-1-yl)propan-2-yl]-4-[4-fluoro-3-(iodomethyl)anilino]quinazolin-6-yl]methanesulfonamide (PubChem CID 89320962) has the molecular formula C25H32FIN6O2S and a molecular weight of 626.54 g/mol. Its IUPAC name is N-[7-[2-(4-ethylpiperazin-1-yl)propan-2-yl]-4-[4-fluoro-3-(iodomethyl)anilino]quinazolin-6-yl]methanesulfonamide.
| Compound Name | N-[7-[2-(4-ethylpiperazin-1-yl)propan-2-yl]-4-[4-fluoro-3-(iodomethyl)anilino]quinazolin-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 89320962 |
| Molecular Formula | C25H32FIN6O2S |
| Molecular Weight | 626.54 g/mol |
| Exact Mass | 626.13 |
| IUPAC Name | N-[7-[2-(4-ethylpiperazin-1-yl)propan-2-yl]-4-[4-fluoro-3-(iodomethyl)anilino]quinazolin-6-yl]methanesulfonamide |
| SMILES | CCN1CCN(C(C)(C)c2cc3ncnc(Nc4ccc(F)c(CI)c4)c3cc2NS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C25H32FIN6O2S/c1-5-32-8-10-33(11-9-32)25(2,3)20-14-22-19(13-23(20)31-36(4,34)35)24(29-16-28-22)30-18-6-7-21(26)17(12-18)15-27/h6-7,12-14,16,31H,5,8-11,15H2,1-4H3,(H,28,29,30) |
| InChIKey | KUFBYYGWHYSUDQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|