C25H28ClFN6O4S2 — CID 58998354
N-[4-(3-chloro-4-fluoroanilino)-7-[3-methyl-3-(4-methylperoxysulfanylpiperazin-1-yl)but-1-ynyl]quinazolin-6-yl]methanesulfonamide (PubChem CID 58998354) has the molecular formula C25H28ClFN6O4S2 and a molecular weight of 595.12 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-7-[3-methyl-3-(4-methylperoxysulfanylpiperazin-1-yl)but-1-ynyl]quinazolin-6-yl]methanesulfonamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-7-[3-methyl-3-(4-methylperoxysulfanylpiperazin-1-yl)but-1-ynyl]quinazolin-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 58998354 |
| Molecular Formula | C25H28ClFN6O4S2 |
| Molecular Weight | 595.12 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-7-[3-methyl-3-(4-methylperoxysulfanylpiperazin-1-yl)but-1-ynyl]quinazolin-6-yl]methanesulfonamide |
| SMILES | COOSN1CCN(C(C)(C)C#Cc2cc3ncnc(Nc4ccc(F)c(Cl)c4)c3cc2NS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C25H28ClFN6O4S2/c1-25(2,32-9-11-33(12-10-32)38-37-36-3)8-7-17-13-23-19(15-22(17)31-39(4,34)35)24(29-16-28-23)30-18-5-6-21(27)20(26)14-18/h5-6,13-16,31H,9-12H2,1-4H3,(H,28,29,30) |
| InChIKey | BJRRFWQYJYTVGF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.12 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|