C28H32FIN6O2 — CID 89321110
N-[4-[4-fluoro-3-(iodomethyl)anilino]-7-[4-(4-methylpiperazin-1-yl)oxan-4-yl]quinazolin-6-yl]prop-2-enamide (PubChem CID 89321110) has the molecular formula C28H32FIN6O2 and a molecular weight of 630.51 g/mol. Its IUPAC name is N-[4-[4-fluoro-3-(iodomethyl)anilino]-7-[4-(4-methylpiperazin-1-yl)oxan-4-yl]quinazolin-6-yl]prop-2-enamide.
| Compound Name | N-[4-[4-fluoro-3-(iodomethyl)anilino]-7-[4-(4-methylpiperazin-1-yl)oxan-4-yl]quinazolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89321110 |
| Molecular Formula | C28H32FIN6O2 |
| Molecular Weight | 630.51 g/mol |
| Exact Mass | 630.16 |
| IUPAC Name | N-[4-[4-fluoro-3-(iodomethyl)anilino]-7-[4-(4-methylpiperazin-1-yl)oxan-4-yl]quinazolin-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(Nc3ccc(F)c(CI)c3)ncnc2cc1C1(N2CCN(C)CC2)CCOCC1 |
| InChI | InChI=1S/C28H32FIN6O2/c1-3-26(37)34-25-15-21-24(31-18-32-27(21)33-20-4-5-23(29)19(14-20)17-30)16-22(25)28(6-12-38-13-7-28)36-10-8-35(2)9-11-36/h3-5,14-16,18H,1,6-13,17H2,2H3,(H,34,37)(H,31,32,33) |
| InChIKey | RCVNXCJLLPPFDR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|