C22H22N4O — CID 167542478
N-(4-anilino-7-prop-1-ynylquinazolin-6-yl)prop-2-enamide;ethane (PubChem CID 167542478) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is N-(4-anilino-7-prop-1-ynylquinazolin-6-yl)prop-2-enamide;ethane.
| Compound Name | N-(4-anilino-7-prop-1-ynylquinazolin-6-yl)prop-2-enamide;ethane |
|---|---|
| PubChem CID | 167542478 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | N-(4-anilino-7-prop-1-ynylquinazolin-6-yl)prop-2-enamide;ethane |
| SMILES | C=CC(=O)Nc1cc2c(Nc3ccccc3)ncnc2cc1C#CC.CC |
| InChI | InChI=1S/C20H16N4O.C2H6/c1-3-8-14-11-18-16(12-17(14)24-19(25)4-2)20(22-13-21-18)23-15-9-6-5-7-10-15;1-2/h4-7,9-13H,2H2,1H3,(H,24,25)(H,21,22,23);1-2H3 |
| InChIKey | BJIKMDKGDWXCOZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|