C30H27ClN6O4 — CID 146470166
[4-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-6-(prop-2-enoylamino)quinazolin-7-yl]-2-methylbut-3-yn-2-yl]-methylcarbamic acid (PubChem CID 146470166) has the molecular formula C30H27ClN6O4 and a molecular weight of 571.04 g/mol. Its IUPAC name is [4-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-6-(prop-2-enoylamino)quinazolin-7-yl]-2-methylbut-3-yn-2-yl]-methylcarbamic acid.
| Compound Name | [4-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-6-(prop-2-enoylamino)quinazolin-7-yl]-2-methylbut-3-yn-2-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 146470166 |
| Molecular Formula | C30H27ClN6O4 |
| Molecular Weight | 571.04 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | [4-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-6-(prop-2-enoylamino)quinazolin-7-yl]-2-methylbut-3-yn-2-yl]-methylcarbamic acid |
| SMILES | C=CC(=O)Nc1cc2c(Nc3ccc(OCc4ccccn4)c(Cl)c3)ncnc2cc1C#CC(C)(C)N(C)C(=O)O |
| InChI | InChI=1S/C30H27ClN6O4/c1-5-27(38)36-24-16-22-25(14-19(24)11-12-30(2,3)37(4)29(39)40)33-18-34-28(22)35-20-9-10-26(23(31)15-20)41-17-21-8-6-7-13-32-21/h5-10,13-16,18H,1,17H2,2-4H3,(H,36,38)(H,39,40)(H,33,34,35) |
| InChIKey | LJPHZAMUOPUASW-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 129.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.04 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|