C28H27ClN6O4 — CID 77269371
N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-methoxyquinazolin-6-yl]-2-(prop-2-enoylamino)butanamide (PubChem CID 77269371) has the molecular formula C28H27ClN6O4 and a molecular weight of 547.02 g/mol. Its IUPAC name is N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-methoxyquinazolin-6-yl]-2-(prop-2-enoylamino)butanamide.
| Compound Name | N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-methoxyquinazolin-6-yl]-2-(prop-2-enoylamino)butanamide |
|---|---|
| PubChem CID | 77269371 |
| Molecular Formula | C28H27ClN6O4 |
| Molecular Weight | 547.02 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-methoxyquinazolin-6-yl]-2-(prop-2-enoylamino)butanamide |
| SMILES | C=CC(=O)NC(CC)C(=O)Nc1cc2c(Nc3ccc(OCc4ccccn4)c(Cl)c3)ncnc2cc1OC |
| InChI | InChI=1S/C28H27ClN6O4/c1-4-21(34-26(36)5-2)28(37)35-23-13-19-22(14-25(23)38-3)31-16-32-27(19)33-17-9-10-24(20(29)12-17)39-15-18-8-6-7-11-30-18/h5-14,16,21H,2,4,15H2,1,3H3,(H,34,36)(H,35,37)(H,31,32,33) |
| InChIKey | KCZIHLFHIGBHQW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.02 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|