C25H23ClFN5O — CID 163562453
6-amino-4-(3-chloro-4-fluoroanilino)-7-(3-methyl-3-morpholin-4-ylbut-1-ynyl)quinoline-3-carbonitrile (PubChem CID 163562453) has the molecular formula C25H23ClFN5O and a molecular weight of 463.94 g/mol. Its IUPAC name is 6-amino-4-(3-chloro-4-fluoroanilino)-7-(3-methyl-3-morpholin-4-ylbut-1-ynyl)quinoline-3-carbonitrile.
| Compound Name | 6-amino-4-(3-chloro-4-fluoroanilino)-7-(3-methyl-3-morpholin-4-ylbut-1-ynyl)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 163562453 |
| Molecular Formula | C25H23ClFN5O |
| Molecular Weight | 463.94 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 6-amino-4-(3-chloro-4-fluoroanilino)-7-(3-methyl-3-morpholin-4-ylbut-1-ynyl)quinoline-3-carbonitrile |
| SMILES | CC(C)(C#Cc1cc2ncc(C#N)c(Nc3ccc(F)c(Cl)c3)c2cc1N)N1CCOCC1 |
| InChI | InChI=1S/C25H23ClFN5O/c1-25(2,32-7-9-33-10-8-32)6-5-16-11-23-19(13-22(16)29)24(17(14-28)15-30-23)31-18-3-4-21(27)20(26)12-18/h3-4,11-13,15H,7-10,29H2,1-2H3,(H,30,31) |
| InChIKey | FSJXXCMAOQLJKT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.94 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|