C24H23ClFN3O3 — CID 58172604
9-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-1-hydroxynon-8-yn-2-one (PubChem CID 58172604) has the molecular formula C24H23ClFN3O3 and a molecular weight of 455.92 g/mol. Its IUPAC name is 9-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-1-hydroxynon-8-yn-2-one.
| Compound Name | 9-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-1-hydroxynon-8-yn-2-one |
|---|---|
| PubChem CID | 58172604 |
| Molecular Formula | C24H23ClFN3O3 |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 9-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-1-hydroxynon-8-yn-2-one |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1C#CCCCCCC(=O)CO |
| InChI | InChI=1S/C24H23ClFN3O3/c1-32-23-13-22-19(11-16(23)7-5-3-2-4-6-8-18(31)14-30)24(28-15-27-22)29-17-9-10-21(26)20(25)12-17/h9-13,15,30H,2-4,6,8,14H2,1H3,(H,27,28,29) |
| InChIKey | ANCBYQMKHJZNMK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|