C26H21ClFN3O4 — CID 143645824
7-[5-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxyfuran-2-yl]hept-6-yn-2-one (PubChem CID 143645824) has the molecular formula C26H21ClFN3O4 and a molecular weight of 493.92 g/mol. Its IUPAC name is 7-[5-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxyfuran-2-yl]hept-6-yn-2-one.
| Compound Name | 7-[5-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxyfuran-2-yl]hept-6-yn-2-one |
|---|---|
| PubChem CID | 143645824 |
| Molecular Formula | C26H21ClFN3O4 |
| Molecular Weight | 493.92 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 7-[5-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxyfuran-2-yl]hept-6-yn-2-one |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1Oc1ccc(C#CCCCC(C)=O)o1 |
| InChI | InChI=1S/C26H21ClFN3O4/c1-16(32)6-4-3-5-7-18-9-11-25(34-18)35-24-13-19-22(14-23(24)33-2)29-15-30-26(19)31-17-8-10-21(28)20(27)12-17/h8-15H,3-4,6H2,1-2H3,(H,29,30,31) |
| InChIKey | RKPRXZPLLQDZHY-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.92 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|