C20H16ClFN4O5 — CID 89006046
5-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxy-2,3-dihydrofuran-2-carboxamide (PubChem CID 89006046) has the molecular formula C20H16ClFN4O5 and a molecular weight of 446.82 g/mol. Its IUPAC name is 5-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxy-2,3-dihydrofuran-2-carboxamide.
| Compound Name | 5-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxy-2,3-dihydrofuran-2-carboxamide |
|---|---|
| PubChem CID | 89006046 |
| Molecular Formula | C20H16ClFN4O5 |
| Molecular Weight | 446.82 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 5-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-N-hydroxy-2,3-dihydrofuran-2-carboxamide |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OC1=CCC(C(=O)NO)O1 |
| InChI | InChI=1S/C20H16ClFN4O5/c1-29-16-8-14-11(7-17(16)31-18-5-4-15(30-18)20(27)26-28)19(24-9-23-14)25-10-2-3-13(22)12(21)6-10/h2-3,5-9,15,28H,4H2,1H3,(H,26,27)(H,23,24,25) |
| InChIKey | JGFFFRLGLCSAOP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 114.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.82 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|