C29H29FN4O4 — CID 143645793
9-[5-[4-(4-fluoro-3-methylanilino)-7-methoxyquinazolin-6-yl]furan-2-yl]-N-hydroxynon-8-ynamide (PubChem CID 143645793) has the molecular formula C29H29FN4O4 and a molecular weight of 516.57 g/mol. Its IUPAC name is 9-[5-[4-(4-fluoro-3-methylanilino)-7-methoxyquinazolin-6-yl]furan-2-yl]-N-hydroxynon-8-ynamide.
| Compound Name | 9-[5-[4-(4-fluoro-3-methylanilino)-7-methoxyquinazolin-6-yl]furan-2-yl]-N-hydroxynon-8-ynamide |
|---|---|
| PubChem CID | 143645793 |
| Molecular Formula | C29H29FN4O4 |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 9-[5-[4-(4-fluoro-3-methylanilino)-7-methoxyquinazolin-6-yl]furan-2-yl]-N-hydroxynon-8-ynamide |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(C)c3)c2cc1-c1ccc(C#CCCCCCCC(=O)NO)o1 |
| InChI | InChI=1S/C29H29FN4O4/c1-19-15-20(11-13-24(19)30)33-29-22-16-23(27(37-2)17-25(22)31-18-32-29)26-14-12-21(38-26)9-7-5-3-4-6-8-10-28(35)34-36/h11-18,36H,3-6,8,10H2,1-2H3,(H,34,35)(H,31,32,33) |
| InChIKey | LZHNVQTUTWQHJM-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 109.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|