C24H25N5O3 — CID 151576417
2-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-2,4-dimethylpiperazine-1-carboxylic acid (PubChem CID 151576417) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol. Its IUPAC name is 2-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-2,4-dimethylpiperazine-1-carboxylic acid.
| Compound Name | 2-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-2,4-dimethylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 151576417 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 2-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-2,4-dimethylpiperazine-1-carboxylic acid |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(C4(C)CN(C)CCN4C(=O)O)cc23)c1 |
| InChI | InChI=1S/C24H25N5O3/c1-5-16-7-6-8-17(11-16)27-22-18-12-19(21(32-4)13-20(18)25-15-26-22)24(2)14-28(3)9-10-29(24)23(30)31/h1,6-8,11-13,15H,9-10,14H2,2-4H3,(H,30,31)(H,25,26,27) |
| InChIKey | QFNWOTPVKIKRSB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|