C31H35N5O5 — CID 59382772
tert-butyl 4-[2-[[4-(3-ethynylanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]amino]-2-oxoethylidene]piperidine-1-carboxylate (PubChem CID 59382772) has the molecular formula C31H35N5O5 and a molecular weight of 557.65 g/mol. Its IUPAC name is tert-butyl 4-[2-[[4-(3-ethynylanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]amino]-2-oxoethylidene]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[4-(3-ethynylanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]amino]-2-oxoethylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59382772 |
| Molecular Formula | C31H35N5O5 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | tert-butyl 4-[2-[[4-(3-ethynylanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]amino]-2-oxoethylidene]piperidine-1-carboxylate |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCOC)c(NC(=O)C=C4CCN(C(=O)OC(C)(C)C)CC4)cc23)c1 |
| InChI | InChI=1S/C31H35N5O5/c1-6-21-8-7-9-23(16-21)34-29-24-18-26(27(40-15-14-39-5)19-25(24)32-20-33-29)35-28(37)17-22-10-12-36(13-11-22)30(38)41-31(2,3)4/h1,7-9,16-20H,10-15H2,2-5H3,(H,35,37)(H,32,33,34) |
| InChIKey | PYAYMPDQMYBGTG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|