C32H39N7O4 — CID 42600626
(2S)-N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-2-[(1-methylpiperidine-2-carbonyl)amino]octanediamide (PubChem CID 42600626) has the molecular formula C32H39N7O4 and a molecular weight of 585.71 g/mol. Its IUPAC name is (2S)-N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-2-[(1-methylpiperidine-2-carbonyl)amino]octanediamide.
| Compound Name | (2S)-N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-2-[(1-methylpiperidine-2-carbonyl)amino]octanediamide |
|---|---|
| PubChem CID | 42600626 |
| Molecular Formula | C32H39N7O4 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.31 |
| IUPAC Name | (2S)-N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]-2-[(1-methylpiperidine-2-carbonyl)amino]octanediamide |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(NC(=O)[C@H](CCCCCC(N)=O)NC(=O)C4CCCCN4C)cc23)c1 |
| InChI | InChI=1S/C32H39N7O4/c1-4-21-11-10-12-22(17-21)36-30-23-18-26(28(43-3)19-25(23)34-20-35-30)38-31(41)24(13-6-5-7-15-29(33)40)37-32(42)27-14-8-9-16-39(27)2/h1,10-12,17-20,24,27H,5-9,13-16H2,2-3H3,(H2,33,40)(H,37,42)(H,38,41)(H,34,35,36)/t24-,27?/m0/s1 |
| InChIKey | SDQUAQWQAFOCOX-BXXZMZEQSA-N |
| XLogP | 3.71 |
| TPSA | 151.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|