C25H28N6O — CID 91299879
N-[4-(3-ethenylanilino)quinazolin-6-yl]-2-(1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl)acetamide (PubChem CID 91299879) has the molecular formula C25H28N6O and a molecular weight of 428.54 g/mol. Its IUPAC name is N-[4-(3-ethenylanilino)quinazolin-6-yl]-2-(1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl)acetamide.
| Compound Name | N-[4-(3-ethenylanilino)quinazolin-6-yl]-2-(1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl)acetamide |
|---|---|
| PubChem CID | 91299879 |
| Molecular Formula | C25H28N6O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | N-[4-(3-ethenylanilino)quinazolin-6-yl]-2-(1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl)acetamide |
| SMILES | C=Cc1cccc(Nc2ncnc3ccc(NC(=O)CN4CC5CCN(C)C5C4)cc23)c1 |
| InChI | InChI=1S/C25H28N6O/c1-3-17-5-4-6-19(11-17)29-25-21-12-20(7-8-22(21)26-16-27-25)28-24(32)15-31-13-18-9-10-30(2)23(18)14-31/h3-8,11-12,16,18,23H,1,9-10,13-15H2,2H3,(H,28,32)(H,26,27,29) |
| InChIKey | BEIBPYGKIDOQJX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |