C34H33N7O6 — CID 87553683
[2-[[5-[[4-(3-ethynylanilino)quinazolin-6-yl]carbamoyl]pyridine-2-carbonyl]amino]phenyl] N-tert-butylcarbamate;dihydrate (PubChem CID 87553683) has the molecular formula C34H33N7O6 and a molecular weight of 635.68 g/mol. Its IUPAC name is [2-[[5-[[4-(3-ethynylanilino)quinazolin-6-yl]carbamoyl]pyridine-2-carbonyl]amino]phenyl] N-tert-butylcarbamate;dihydrate.
| Compound Name | [2-[[5-[[4-(3-ethynylanilino)quinazolin-6-yl]carbamoyl]pyridine-2-carbonyl]amino]phenyl] N-tert-butylcarbamate;dihydrate |
|---|---|
| PubChem CID | 87553683 |
| Molecular Formula | C34H33N7O6 |
| Molecular Weight | 635.68 g/mol |
| Exact Mass | 635.25 |
| IUPAC Name | [2-[[5-[[4-(3-ethynylanilino)quinazolin-6-yl]carbamoyl]pyridine-2-carbonyl]amino]phenyl] N-tert-butylcarbamate;dihydrate |
| SMILES | C#Cc1cccc(Nc2ncnc3ccc(NC(=O)c4ccc(C(=O)Nc5ccccc5OC(=O)NC(C)(C)C)nc4)cc23)c1.O.O |
| InChI | InChI=1S/C34H29N7O4.2H2O/c1-5-21-9-8-10-23(17-21)38-30-25-18-24(14-16-26(25)36-20-37-30)39-31(42)22-13-15-28(35-19-22)32(43)40-27-11-6-7-12-29(27)45-33(44)41-34(2,3)4;;/h1,6-20H,2-4H3,(H,39,42)(H,40,43)(H,41,44)(H,36,37,38);2*1H2 |
| InChIKey | GWHZAAIQAHVHKT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 210.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.68 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|