C25H23ClN4O3 — CID 146946385
N-[4-(3-chloroanilino)quinazolin-6-yl]-3,4-diethoxybenzamide (PubChem CID 146946385) has the molecular formula C25H23ClN4O3 and a molecular weight of 462.94 g/mol. Its IUPAC name is N-[4-(3-chloroanilino)quinazolin-6-yl]-3,4-diethoxybenzamide.
| Compound Name | N-[4-(3-chloroanilino)quinazolin-6-yl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 146946385 |
| Molecular Formula | C25H23ClN4O3 |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | N-[4-(3-chloroanilino)quinazolin-6-yl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc3ncnc(Nc4cccc(Cl)c4)c3c2)cc1OCC |
| InChI | InChI=1S/C25H23ClN4O3/c1-3-32-22-11-8-16(12-23(22)33-4-2)25(31)30-19-9-10-21-20(14-19)24(28-15-27-21)29-18-7-5-6-17(26)13-18/h5-15H,3-4H2,1-2H3,(H,30,31)(H,27,28,29) |
| InChIKey | AHWHROUPQPNHRI-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |