C43H43N7O7 — CID 25141186
N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine;pyridin-3-ylmethyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamate (PubChem CID 25141186) has the molecular formula C43H43N7O7 and a molecular weight of 769.86 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine;pyridin-3-ylmethyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamate.
| Compound Name | N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine;pyridin-3-ylmethyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 25141186 |
| Molecular Formula | C43H43N7O7 |
| Molecular Weight | 769.86 g/mol |
| Exact Mass | 769.32 |
| IUPAC Name | N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine;pyridin-3-ylmethyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamate |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCOC)c(OCCOC)cc23)c1.Nc1ccccc1NC(=O)c1ccc(CNC(=O)OCc2cccnc2)cc1 |
| InChI | InChI=1S/C22H23N3O4.C21H20N4O3/c1-4-16-6-5-7-17(12-16)25-22-18-13-20(28-10-8-26-2)21(29-11-9-27-3)14-19(18)23-15-24-22;22-18-5-1-2-6-19(18)25-20(26)17-9-7-15(8-10-17)13-24-21(27)28-14-16-4-3-11-23-12-16/h1,5-7,12-15H,8-11H2,2-3H3,(H,23,24,25);1-12H,13-14,22H2,(H,24,27)(H,25,26) |
| InChIKey | BZROYZWDODSCTL-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 181.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.86 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|