C25H19Cl2N5O2S — CID 164620504
N-[3-[[2-[4-(3,4-dichloroanilino)quinazolin-2-yl]sulfanylacetyl]amino]phenyl]prop-2-enamide (PubChem CID 164620504) has the molecular formula C25H19Cl2N5O2S and a molecular weight of 524.43 g/mol. Its IUPAC name is N-[3-[[2-[4-(3,4-dichloroanilino)quinazolin-2-yl]sulfanylacetyl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[4-(3,4-dichloroanilino)quinazolin-2-yl]sulfanylacetyl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 164620504 |
| Molecular Formula | C25H19Cl2N5O2S |
| Molecular Weight | 524.43 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | N-[3-[[2-[4-(3,4-dichloroanilino)quinazolin-2-yl]sulfanylacetyl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(NC(=O)CSc2nc(Nc3ccc(Cl)c(Cl)c3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C25H19Cl2N5O2S/c1-2-22(33)28-15-6-5-7-16(12-15)29-23(34)14-35-25-31-21-9-4-3-8-18(21)24(32-25)30-17-10-11-19(26)20(27)13-17/h2-13H,1,14H2,(H,28,33)(H,29,34)(H,30,31,32) |
| InChIKey | GKNHYFFGFMKJMW-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.43 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|