C19H15Cl2N3OS — CID 142773057
2,6-dichloro-N-(3-ethynylphenyl)-7-(2-methoxyethylsulfanyl)quinazolin-4-amine (PubChem CID 142773057) has the molecular formula C19H15Cl2N3OS and a molecular weight of 404.32 g/mol. Its IUPAC name is 2,6-dichloro-N-(3-ethynylphenyl)-7-(2-methoxyethylsulfanyl)quinazolin-4-amine.
| Compound Name | 2,6-dichloro-N-(3-ethynylphenyl)-7-(2-methoxyethylsulfanyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 142773057 |
| Molecular Formula | C19H15Cl2N3OS |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | 2,6-dichloro-N-(3-ethynylphenyl)-7-(2-methoxyethylsulfanyl)quinazolin-4-amine |
| SMILES | C#Cc1cccc(Nc2nc(Cl)nc3cc(SCCOC)c(Cl)cc23)c1 |
| InChI | InChI=1S/C19H15Cl2N3OS/c1-3-12-5-4-6-13(9-12)22-18-14-10-15(20)17(26-8-7-25-2)11-16(14)23-19(21)24-18/h1,4-6,9-11H,7-8H2,2H3,(H,22,23,24) |
| InChIKey | HZURSSVISHGKNB-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|