C23H20N4O3 — CID 66555108
N-[4-(3-ethynylanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]prop-2-enamide (PubChem CID 66555108) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is N-[4-(3-ethynylanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]prop-2-enamide.
| Compound Name | N-[4-(3-ethynylanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 66555108 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-[4-(3-ethynylanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]prop-2-enamide |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(O[C@H]4CCOC4)c(NC(=O)C=C)cc23)c1 |
| InChI | InChI=1S/C23H20N4O3/c1-3-15-6-5-7-16(10-15)26-23-18-11-20(27-22(28)4-2)21(12-19(18)24-14-25-23)30-17-8-9-29-13-17/h1,4-7,10-12,14,17H,2,8-9,13H2,(H,27,28)(H,24,25,26)/t17-/m0/s1 |
| InChIKey | LLMGJBSMLIPQLV-KRWDZBQOSA-N |
| XLogP | 3.65 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|