C21H24N8O5 — CID 164897053
N-(4,6-dimorpholin-4-ylpyrimidin-2-yl)-7-methoxy-6-nitroquinazolin-4-amine (PubChem CID 164897053) has the molecular formula C21H24N8O5 and a molecular weight of 468.47 g/mol. Its IUPAC name is N-(4,6-dimorpholin-4-ylpyrimidin-2-yl)-7-methoxy-6-nitroquinazolin-4-amine.
| Compound Name | N-(4,6-dimorpholin-4-ylpyrimidin-2-yl)-7-methoxy-6-nitroquinazolin-4-amine |
|---|---|
| PubChem CID | 164897053 |
| Molecular Formula | C21H24N8O5 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | N-(4,6-dimorpholin-4-ylpyrimidin-2-yl)-7-methoxy-6-nitroquinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3nc(N4CCOCC4)cc(N4CCOCC4)n3)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H24N8O5/c1-32-17-11-15-14(10-16(17)29(30)31)20(23-13-22-15)26-21-24-18(27-2-6-33-7-3-27)12-19(25-21)28-4-8-34-9-5-28/h10-13H,2-9H2,1H3,(H,22,23,24,25,26) |
| InChIKey | GWUFLXFQFBEDMZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 140.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|