C17H18ClN7O2 — CID 164897040
4-N-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)-7-methoxyquinazoline-4,6-diamine (PubChem CID 164897040) has the molecular formula C17H18ClN7O2 and a molecular weight of 387.83 g/mol. Its IUPAC name is 4-N-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)-7-methoxyquinazoline-4,6-diamine.
| Compound Name | 4-N-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)-7-methoxyquinazoline-4,6-diamine |
|---|---|
| PubChem CID | 164897040 |
| Molecular Formula | C17H18ClN7O2 |
| Molecular Weight | 387.83 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 4-N-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)-7-methoxyquinazoline-4,6-diamine |
| SMILES | COc1cc2ncnc(Nc3nc(Cl)cc(N4CCOCC4)n3)c2cc1N |
| InChI | InChI=1S/C17H18ClN7O2/c1-26-13-7-12-10(6-11(13)19)16(21-9-20-12)24-17-22-14(18)8-15(23-17)25-2-4-27-5-3-25/h6-9H,2-5,19H2,1H3,(H,20,21,22,23,24) |
| InChIKey | VWDCRFSKCMCZGV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.83 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|