C18H20N6O2 — CID 175297707
7-methoxy-2-(2-morpholin-4-yl-4-pyridinyl)quinazoline-4,6-diamine (PubChem CID 175297707) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 7-methoxy-2-(2-morpholin-4-yl-4-pyridinyl)quinazoline-4,6-diamine.
| Compound Name | 7-methoxy-2-(2-morpholin-4-yl-4-pyridinyl)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 175297707 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 7-methoxy-2-(2-morpholin-4-yl-4-pyridinyl)quinazoline-4,6-diamine |
| SMILES | COc1cc2nc(-c3ccnc(N4CCOCC4)c3)nc(N)c2cc1N |
| InChI | InChI=1S/C18H20N6O2/c1-25-15-10-14-12(9-13(15)19)17(20)23-18(22-14)11-2-3-21-16(8-11)24-4-6-26-7-5-24/h2-3,8-10H,4-7,19H2,1H3,(H2,20,22,23) |
| InChIKey | YBIYQYOZERKKFS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|