C23H26N4O4 — CID 118733925
3-(6,7-dimethoxy-4-morpholin-4-ylquinazolin-2-yl)-N,N-dimethylbenzamide (PubChem CID 118733925) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 3-(6,7-dimethoxy-4-morpholin-4-ylquinazolin-2-yl)-N,N-dimethylbenzamide.
| Compound Name | 3-(6,7-dimethoxy-4-morpholin-4-ylquinazolin-2-yl)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 118733925 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 3-(6,7-dimethoxy-4-morpholin-4-ylquinazolin-2-yl)-N,N-dimethylbenzamide |
| SMILES | COc1cc2nc(-c3cccc(C(=O)N(C)C)c3)nc(N3CCOCC3)c2cc1OC |
| InChI | InChI=1S/C23H26N4O4/c1-26(2)23(28)16-7-5-6-15(12-16)21-24-18-14-20(30-4)19(29-3)13-17(18)22(25-21)27-8-10-31-11-9-27/h5-7,12-14H,8-11H2,1-4H3 |
| InChIKey | ZBQYLLPVKDIKDW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |