C13H12ClN7O2 — CID 10404612
6-chloro-2-N-(6,7-dimethoxyquinazolin-4-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 10404612) has the molecular formula C13H12ClN7O2 and a molecular weight of 333.74 g/mol. Its IUPAC name is 6-chloro-2-N-(6,7-dimethoxyquinazolin-4-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(6,7-dimethoxyquinazolin-4-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 10404612 |
| Molecular Formula | C13H12ClN7O2 |
| Molecular Weight | 333.74 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 6-chloro-2-N-(6,7-dimethoxyquinazolin-4-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1cc2ncnc(Nc3nc(N)nc(Cl)n3)c2cc1OC |
| InChI | InChI=1S/C13H12ClN7O2/c1-22-8-3-6-7(4-9(8)23-2)16-5-17-10(6)18-13-20-11(14)19-12(15)21-13/h3-5H,1-2H3,(H3,15,16,17,18,19,20,21) |
| InChIKey | ZNWWRKHBEMVONI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.74 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |