C22H20BrF2N5O4 — CID 69307447
1-[4-[[4-(4-bromo-2,6-difluoroanilino)-6-nitroquinazolin-7-yl]oxymethyl]piperidin-1-yl]ethanone (PubChem CID 69307447) has the molecular formula C22H20BrF2N5O4 and a molecular weight of 536.33 g/mol. Its IUPAC name is 1-[4-[[4-(4-bromo-2,6-difluoroanilino)-6-nitroquinazolin-7-yl]oxymethyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[[4-(4-bromo-2,6-difluoroanilino)-6-nitroquinazolin-7-yl]oxymethyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 69307447 |
| Molecular Formula | C22H20BrF2N5O4 |
| Molecular Weight | 536.33 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | 1-[4-[[4-(4-bromo-2,6-difluoroanilino)-6-nitroquinazolin-7-yl]oxymethyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(COc2cc3ncnc(Nc4c(F)cc(Br)cc4F)c3cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H20BrF2N5O4/c1-12(31)29-4-2-13(3-5-29)10-34-20-9-18-15(8-19(20)30(32)33)22(27-11-26-18)28-21-16(24)6-14(23)7-17(21)25/h6-9,11,13H,2-5,10H2,1H3,(H,26,27,28) |
| InChIKey | UFALEIGTPLQFSY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.33 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|