C12H14ClFN2O — CID 28969312
(2R)-N-(3-chloro-2-fluorophenyl)piperidine-2-carboxamide (PubChem CID 28969312) has the molecular formula C12H14ClFN2O and a molecular weight of 256.71 g/mol. Its IUPAC name is (2R)-N-(3-chloro-2-fluorophenyl)piperidine-2-carboxamide.
| Compound Name | (2R)-N-(3-chloro-2-fluorophenyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 28969312 |
| Molecular Formula | C12H14ClFN2O |
| Molecular Weight | 256.71 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | (2R)-N-(3-chloro-2-fluorophenyl)piperidine-2-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1F)[C@H]1CCCCN1 |
| InChI | InChI=1S/C12H14ClFN2O/c13-8-4-3-6-9(11(8)14)16-12(17)10-5-1-2-7-15-10/h3-4,6,10,15H,1-2,5,7H2,(H,16,17)/t10-/m1/s1 |
| InChIKey | KYRXDFDVTWXCGL-SNVBAGLBSA-N |
| XLogP | 2.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.71 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |