C14H16ClN5O — CID 104913077
(2S)-N-[3-chloro-2-(1,2,4-triazol-1-yl)phenyl]piperidine-2-carboxamide (PubChem CID 104913077) has the molecular formula C14H16ClN5O and a molecular weight of 305.77 g/mol. Its IUPAC name is (2S)-N-[3-chloro-2-(1,2,4-triazol-1-yl)phenyl]piperidine-2-carboxamide.
| Compound Name | (2S)-N-[3-chloro-2-(1,2,4-triazol-1-yl)phenyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 104913077 |
| Molecular Formula | C14H16ClN5O |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | (2S)-N-[3-chloro-2-(1,2,4-triazol-1-yl)phenyl]piperidine-2-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1-n1cncn1)[C@@H]1CCCCN1 |
| InChI | InChI=1S/C14H16ClN5O/c15-10-4-3-6-11(13(10)20-9-16-8-18-20)19-14(21)12-5-1-2-7-17-12/h3-4,6,8-9,12,17H,1-2,5,7H2,(H,19,21)/t12-/m0/s1 |
| InChIKey | CMPZGHVSFHJFGE-LBPRGKRZSA-N |
| XLogP | 2.00 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |