C14H14ClN5O — CID 79210127
4-amino-N-[3-chloro-2-(1,2,4-triazol-1-yl)phenyl]cyclopent-2-ene-1-carboxamide (PubChem CID 79210127) has the molecular formula C14H14ClN5O and a molecular weight of 303.75 g/mol. Its IUPAC name is 4-amino-N-[3-chloro-2-(1,2,4-triazol-1-yl)phenyl]cyclopent-2-ene-1-carboxamide.
| Compound Name | 4-amino-N-[3-chloro-2-(1,2,4-triazol-1-yl)phenyl]cyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 79210127 |
| Molecular Formula | C14H14ClN5O |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 4-amino-N-[3-chloro-2-(1,2,4-triazol-1-yl)phenyl]cyclopent-2-ene-1-carboxamide |
| SMILES | NC1C=CC(C(=O)Nc2cccc(Cl)c2-n2cncn2)C1 |
| InChI | InChI=1S/C14H14ClN5O/c15-11-2-1-3-12(13(11)20-8-17-7-18-20)19-14(21)9-4-5-10(16)6-9/h1-5,7-10H,6,16H2,(H,19,21) |
| InChIKey | XWNJJDJCWMYDEY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|