C12H14ClN5O2 — CID 79473828
2-(2-aminoethoxy)-N-[3-chloro-2-(1,2,4-triazol-1-yl)phenyl]acetamide (PubChem CID 79473828) has the molecular formula C12H14ClN5O2 and a molecular weight of 295.73 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-N-[3-chloro-2-(1,2,4-triazol-1-yl)phenyl]acetamide.
| Compound Name | 2-(2-aminoethoxy)-N-[3-chloro-2-(1,2,4-triazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 79473828 |
| Molecular Formula | C12H14ClN5O2 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-(2-aminoethoxy)-N-[3-chloro-2-(1,2,4-triazol-1-yl)phenyl]acetamide |
| SMILES | NCCOCC(=O)Nc1cccc(Cl)c1-n1cncn1 |
| InChI | InChI=1S/C12H14ClN5O2/c13-9-2-1-3-10(12(9)18-8-15-7-16-18)17-11(19)6-20-5-4-14/h1-3,7-8H,4-6,14H2,(H,17,19) |
| InChIKey | LVSFATSOCOXNAN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|