C17H17ClN4O — CID 154774877
N-[3-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3,3-dicyclopropylprop-2-enamide (PubChem CID 154774877) has the molecular formula C17H17ClN4O and a molecular weight of 328.80 g/mol. Its IUPAC name is N-[3-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3,3-dicyclopropylprop-2-enamide.
| Compound Name | N-[3-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3,3-dicyclopropylprop-2-enamide |
|---|---|
| PubChem CID | 154774877 |
| Molecular Formula | C17H17ClN4O |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-[3-chloro-2-(1,2,4-triazol-1-yl)phenyl]-3,3-dicyclopropylprop-2-enamide |
| SMILES | O=C(C=C(C1CC1)C1CC1)Nc1cccc(Cl)c1-n1cncn1 |
| InChI | InChI=1S/C17H17ClN4O/c18-14-2-1-3-15(17(14)22-10-19-9-20-22)21-16(23)8-13(11-4-5-11)12-6-7-12/h1-3,8-12H,4-7H2,(H,21,23) |
| InChIKey | SSPHGMHIFCKGGA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|