C13H13ClN2O3 — CID 79208298
2-[(4-aminocyclopent-2-ene-1-carbonyl)amino]-6-chlorobenzoic acid (PubChem CID 79208298) has the molecular formula C13H13ClN2O3 and a molecular weight of 280.71 g/mol. Its IUPAC name is 2-[(4-aminocyclopent-2-ene-1-carbonyl)amino]-6-chlorobenzoic acid.
| Compound Name | 2-[(4-aminocyclopent-2-ene-1-carbonyl)amino]-6-chlorobenzoic acid |
|---|---|
| PubChem CID | 79208298 |
| Molecular Formula | C13H13ClN2O3 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2-[(4-aminocyclopent-2-ene-1-carbonyl)amino]-6-chlorobenzoic acid |
| SMILES | NC1C=CC(C(=O)Nc2cccc(Cl)c2C(=O)O)C1 |
| InChI | InChI=1S/C13H13ClN2O3/c14-9-2-1-3-10(11(9)13(18)19)16-12(17)7-4-5-8(15)6-7/h1-5,7-8H,6,15H2,(H,16,17)(H,18,19) |
| InChIKey | XIPIILCQLMSMFM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|