C13H12F2N2O3 — CID 79207142
2-[(4-aminocyclopent-2-ene-1-carbonyl)amino]-4,5-difluorobenzoic acid (PubChem CID 79207142) has the molecular formula C13H12F2N2O3 and a molecular weight of 282.25 g/mol. Its IUPAC name is 2-[(4-aminocyclopent-2-ene-1-carbonyl)amino]-4,5-difluorobenzoic acid.
| Compound Name | 2-[(4-aminocyclopent-2-ene-1-carbonyl)amino]-4,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 79207142 |
| Molecular Formula | C13H12F2N2O3 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-[(4-aminocyclopent-2-ene-1-carbonyl)amino]-4,5-difluorobenzoic acid |
| SMILES | NC1C=CC(C(=O)Nc2cc(F)c(F)cc2C(=O)O)C1 |
| InChI | InChI=1S/C13H12F2N2O3/c14-9-4-8(13(19)20)11(5-10(9)15)17-12(18)6-1-2-7(16)3-6/h1-2,4-7H,3,16H2,(H,17,18)(H,19,20) |
| InChIKey | PTUOQIPMZUNXED-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|