C14H16N2O4 — CID 115411484
2-[(4-aminocyclopent-2-ene-1-carbonyl)amino]-5-methoxybenzoic acid (PubChem CID 115411484) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 2-[(4-aminocyclopent-2-ene-1-carbonyl)amino]-5-methoxybenzoic acid.
| Compound Name | 2-[(4-aminocyclopent-2-ene-1-carbonyl)amino]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 115411484 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-[(4-aminocyclopent-2-ene-1-carbonyl)amino]-5-methoxybenzoic acid |
| SMILES | COc1ccc(NC(=O)C2C=CC(N)C2)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H16N2O4/c1-20-10-4-5-12(11(7-10)14(18)19)16-13(17)8-2-3-9(15)6-8/h2-5,7-9H,6,15H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | AFOQVJJYOBPCPP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|