C13H15BrN2O2 — CID 79207502
4-amino-N-(5-bromo-2-methoxyphenyl)cyclopent-2-ene-1-carboxamide (PubChem CID 79207502) has the molecular formula C13H15BrN2O2 and a molecular weight of 311.18 g/mol. Its IUPAC name is 4-amino-N-(5-bromo-2-methoxyphenyl)cyclopent-2-ene-1-carboxamide.
| Compound Name | 4-amino-N-(5-bromo-2-methoxyphenyl)cyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 79207502 |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 4-amino-N-(5-bromo-2-methoxyphenyl)cyclopent-2-ene-1-carboxamide |
| SMILES | COc1ccc(Br)cc1NC(=O)C1C=CC(N)C1 |
| InChI | InChI=1S/C13H15BrN2O2/c1-18-12-5-3-9(14)7-11(12)16-13(17)8-2-4-10(15)6-8/h2-5,7-8,10H,6,15H2,1H3,(H,16,17) |
| InChIKey | WDCAPNNHQNQSOK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|