C13H13FN2O3 — CID 79208389
4-[(4-aminocyclopent-2-ene-1-carbonyl)amino]-3-fluorobenzoic acid (PubChem CID 79208389) has the molecular formula C13H13FN2O3 and a molecular weight of 264.26 g/mol. Its IUPAC name is 4-[(4-aminocyclopent-2-ene-1-carbonyl)amino]-3-fluorobenzoic acid.
| Compound Name | 4-[(4-aminocyclopent-2-ene-1-carbonyl)amino]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 79208389 |
| Molecular Formula | C13H13FN2O3 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 4-[(4-aminocyclopent-2-ene-1-carbonyl)amino]-3-fluorobenzoic acid |
| SMILES | NC1C=CC(C(=O)Nc2ccc(C(=O)O)cc2F)C1 |
| InChI | InChI=1S/C13H13FN2O3/c14-10-6-8(13(18)19)2-4-11(10)16-12(17)7-1-3-9(15)5-7/h1-4,6-7,9H,5,15H2,(H,16,17)(H,18,19) |
| InChIKey | ZHBZUELPMZKKAW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|