C26H28N6O4 — CID 121408943
N-[4-[benzylcarbamoyl(methyl)amino]-7-methoxyquinazolin-6-yl]-1-prop-2-enoylpyrrolidine-2-carboxamide (PubChem CID 121408943) has the molecular formula C26H28N6O4 and a molecular weight of 488.55 g/mol. Its IUPAC name is N-[4-[benzylcarbamoyl(methyl)amino]-7-methoxyquinazolin-6-yl]-1-prop-2-enoylpyrrolidine-2-carboxamide.
| Compound Name | N-[4-[benzylcarbamoyl(methyl)amino]-7-methoxyquinazolin-6-yl]-1-prop-2-enoylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 121408943 |
| Molecular Formula | C26H28N6O4 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | N-[4-[benzylcarbamoyl(methyl)amino]-7-methoxyquinazolin-6-yl]-1-prop-2-enoylpyrrolidine-2-carboxamide |
| SMILES | C=CC(=O)N1CCCC1C(=O)Nc1cc2c(N(C)C(=O)NCc3ccccc3)ncnc2cc1OC |
| InChI | InChI=1S/C26H28N6O4/c1-4-23(33)32-12-8-11-21(32)25(34)30-20-13-18-19(14-22(20)36-3)28-16-29-24(18)31(2)26(35)27-15-17-9-6-5-7-10-17/h4-7,9-10,13-14,16,21H,1,8,11-12,15H2,2-3H3,(H,27,35)(H,30,34) |
| InChIKey | NTCFVQNUQIIMLT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|