C20H16Cl2FN5O — CID 160635211
6-(1-buta-1,3-dien-2-ylazetidin-3-yl)oxy-N-(3,4-dichloro-2-fluorophenyl)pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 160635211) has the molecular formula C20H16Cl2FN5O and a molecular weight of 432.29 g/mol. Its IUPAC name is 6-(1-buta-1,3-dien-2-ylazetidin-3-yl)oxy-N-(3,4-dichloro-2-fluorophenyl)pyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-(1-buta-1,3-dien-2-ylazetidin-3-yl)oxy-N-(3,4-dichloro-2-fluorophenyl)pyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 160635211 |
| Molecular Formula | C20H16Cl2FN5O |
| Molecular Weight | 432.29 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 6-(1-buta-1,3-dien-2-ylazetidin-3-yl)oxy-N-(3,4-dichloro-2-fluorophenyl)pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | C=CC(=C)N1CC(Oc2cc3c(Nc4ccc(Cl)c(Cl)c4F)ncnc3cn2)C1 |
| InChI | InChI=1S/C20H16Cl2FN5O/c1-3-11(2)28-8-12(9-28)29-17-6-13-16(7-24-17)25-10-26-20(13)27-15-5-4-14(21)18(22)19(15)23/h3-7,10,12H,1-2,8-9H2,(H,25,26,27) |
| InChIKey | VMJRBZDQDJLDGU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.29 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|