C19H14Cl3N5O2 — CID 155243121
1-[3-[4-(2,4,6-trichloroanilino)pyrido[3,4-d]pyrimidin-6-yl]oxyazetidin-1-yl]prop-2-en-1-one (PubChem CID 155243121) has the molecular formula C19H14Cl3N5O2 and a molecular weight of 450.71 g/mol. Its IUPAC name is 1-[3-[4-(2,4,6-trichloroanilino)pyrido[3,4-d]pyrimidin-6-yl]oxyazetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-(2,4,6-trichloroanilino)pyrido[3,4-d]pyrimidin-6-yl]oxyazetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155243121 |
| Molecular Formula | C19H14Cl3N5O2 |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | 1-[3-[4-(2,4,6-trichloroanilino)pyrido[3,4-d]pyrimidin-6-yl]oxyazetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(Oc2cc3c(Nc4c(Cl)cc(Cl)cc4Cl)ncnc3cn2)C1 |
| InChI | InChI=1S/C19H14Cl3N5O2/c1-2-17(28)27-7-11(8-27)29-16-5-12-15(6-23-16)24-9-25-19(12)26-18-13(21)3-10(20)4-14(18)22/h2-6,9,11H,1,7-8H2,(H,24,25,26) |
| InChIKey | WQAHZNGFRUCJPJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|